C23H18N2S+2 — CID 164517966
1-methyl-2-(1-phenylpyridin-1-ium-4-yl)benzo[e][1,3]benzothiazol-1-ium (PubChem CID 164517966) has the molecular formula C23H18N2S+2 and a molecular weight of 354.48 g/mol. Its IUPAC name is 1-methyl-2-(1-phenylpyridin-1-ium-4-yl)benzo[e][1,3]benzothiazol-1-ium.
| Compound Name | 1-methyl-2-(1-phenylpyridin-1-ium-4-yl)benzo[e][1,3]benzothiazol-1-ium |
|---|---|
| PubChem CID | 164517966 |
| Molecular Formula | C23H18N2S+2 |
| Molecular Weight | 354.48 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | 1-methyl-2-(1-phenylpyridin-1-ium-4-yl)benzo[e][1,3]benzothiazol-1-ium |
| SMILES | C[n+]1c(-c2cc[n+](-c3ccccc3)cc2)sc2ccc3ccccc3c21 |
| InChI | InChI=1S/C23H18N2S/c1-24-22-20-10-6-5-7-17(20)11-12-21(22)26-23(24)18-13-15-25(16-14-18)19-8-3-2-4-9-19/h2-16H,1H3/q+2 |
| InChIKey | VISOADOSVYYEGA-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 7.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.48 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|