C29H24N2+2 — CID 102138049
1-methyl-4-[1-[4-(4-phenylphenyl)phenyl]pyridin-1-ium-4-yl]pyridin-1-ium (PubChem CID 102138049) has the molecular formula C29H24N2+2 and a molecular weight of 400.53 g/mol. Its IUPAC name is 1-methyl-4-[1-[4-(4-phenylphenyl)phenyl]pyridin-1-ium-4-yl]pyridin-1-ium.
| Compound Name | 1-methyl-4-[1-[4-(4-phenylphenyl)phenyl]pyridin-1-ium-4-yl]pyridin-1-ium |
|---|---|
| PubChem CID | 102138049 |
| Molecular Formula | C29H24N2+2 |
| Molecular Weight | 400.53 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | 1-methyl-4-[1-[4-(4-phenylphenyl)phenyl]pyridin-1-ium-4-yl]pyridin-1-ium |
| SMILES | C[n+]1ccc(-c2cc[n+](-c3ccc(-c4ccc(-c5ccccc5)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C29H24N2/c1-30-19-15-27(16-20-30)28-17-21-31(22-18-28)29-13-11-26(12-14-29)25-9-7-24(8-10-25)23-5-3-2-4-6-23/h2-22H,1H3/q+2 |
| InChIKey | CTNVYBHQCYTDJP-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 7.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.53 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|