C24H22Cl2N2O8 — CID 71406463
1-(4-methylphenyl)-4-[1-(4-methylphenyl)pyridin-1-ium-4-yl]pyridin-1-ium diperchlorate (PubChem CID 71406463) has the molecular formula C24H22Cl2N2O8 and a molecular weight of 537.35 g/mol. Its IUPAC name is 1-(4-methylphenyl)-4-[1-(4-methylphenyl)pyridin-1-ium-4-yl]pyridin-1-ium diperchlorate.
| Compound Name | 1-(4-methylphenyl)-4-[1-(4-methylphenyl)pyridin-1-ium-4-yl]pyridin-1-ium diperchlorate |
|---|---|
| PubChem CID | 71406463 |
| Molecular Formula | C24H22Cl2N2O8 |
| Molecular Weight | 537.35 g/mol |
| Exact Mass | 536.08 |
| IUPAC Name | 1-(4-methylphenyl)-4-[1-(4-methylphenyl)pyridin-1-ium-4-yl]pyridin-1-ium diperchlorate |
| SMILES | Cc1ccc(-[n+]2ccc(-c3cc[n+](-c4ccc(C)cc4)cc3)cc2)cc1.[O-][Cl+3]([O-])([O-])[O-].[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C24H22N2.2ClHO4/c1-19-3-7-23(8-4-19)25-15-11-21(12-16-25)22-13-17-26(18-14-22)24-9-5-20(2)6-10-24;2*2-1(3,4)5/h3-18H,1-2H3;2*(H,2,3,4,5)/q+2;;/p-2 |
| InChIKey | TWTXAFXGKAHFEG-UHFFFAOYSA-L |
| XLogP | -4.99 |
| TPSA | 192.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.35 |
| LogP ≤ 5 | -4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|