C30H36N4+2 — CID 177452620
4-[4-[1-[4-(diethylamino)phenyl]pyridin-1-ium-4-yl]pyridin-1-ium-1-yl]-N,N-diethylaniline (PubChem CID 177452620) has the molecular formula C30H36N4+2 and a molecular weight of 452.65 g/mol. Its IUPAC name is 4-[4-[1-[4-(diethylamino)phenyl]pyridin-1-ium-4-yl]pyridin-1-ium-1-yl]-N,N-diethylaniline.
| Compound Name | 4-[4-[1-[4-(diethylamino)phenyl]pyridin-1-ium-4-yl]pyridin-1-ium-1-yl]-N,N-diethylaniline |
|---|---|
| PubChem CID | 177452620 |
| Molecular Formula | C30H36N4+2 |
| Molecular Weight | 452.65 g/mol |
| Exact Mass | 452.29 |
| IUPAC Name | 4-[4-[1-[4-(diethylamino)phenyl]pyridin-1-ium-4-yl]pyridin-1-ium-1-yl]-N,N-diethylaniline |
| SMILES | CCN(CC)c1ccc(-[n+]2ccc(-c3cc[n+](-c4ccc(N(CC)CC)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C30H36N4/c1-5-31(6-2)27-9-13-29(14-10-27)33-21-17-25(18-22-33)26-19-23-34(24-20-26)30-15-11-28(12-16-30)32(7-3)8-4/h9-24H,5-8H2,1-4H3/q+2 |
| InChIKey | RVGXJKKWNRDWND-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 14.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.65 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|