C21H21AgClO4P — CID 135045911
silver;tris(4-methylphenyl)phosphane;perchlorate (PubChem CID 135045911) has the molecular formula C21H21AgClO4P and a molecular weight of 511.69 g/mol. Its IUPAC name is silver;tris(4-methylphenyl)phosphane;perchlorate.
| Compound Name | silver;tris(4-methylphenyl)phosphane;perchlorate |
|---|---|
| PubChem CID | 135045911 |
| Molecular Formula | C21H21AgClO4P |
| Molecular Weight | 511.69 g/mol |
| Exact Mass | 509.99 |
| IUPAC Name | silver;tris(4-methylphenyl)phosphane;perchlorate |
| SMILES | Cc1ccc(P(c2ccc(C)cc2)c2ccc(C)cc2)cc1.[Ag+].[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C21H21P.Ag.ClHO4/c1-16-4-10-19(11-5-16)22(20-12-6-17(2)7-13-20)21-14-8-18(3)9-15-21;;2-1(3,4)5/h4-15H,1-3H3;;(H,2,3,4,5)/q;+1;/p-1 |
| InChIKey | ATRWBLBCOCOGGD-UHFFFAOYSA-M |
| XLogP | -0.39 |
| TPSA | 92.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.69 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|