About palladium(2+);tris(4-methylphenyl)phosphane;diacetate
palladium(2+);tris(4-methylphenyl)phosphane;diacetate (PubChem CID 173264842) has the molecular formula C25H27O4PPd
and a molecular weight of 528.88 g/mol. Its IUPAC name is palladium(2+);tris(4-methylphenyl)phosphane;diacetate.
Molecular Properties
| Compound Name | palladium(2+);tris(4-methylphenyl)phosphane;diacetate |
| PubChem CID | 173264842 |
| Molecular Formula | C25H27O4PPd |
| Molecular Weight | 528.88 g/mol |
| Exact Mass | 528.07 |
| IUPAC Name | palladium(2+);tris(4-methylphenyl)phosphane;diacetate |
| SMILES | CC(=O)[O-].CC(=O)[O-].Cc1ccc(P(c2ccc(C)cc2)c2ccc(C)cc2)cc1.[Pd+2] |
| InChI | InChI=1S/C21H21P.2C2H4O2.Pd/c1-16-4-10-19(11-5-16)22(20-12-6-17(2)7-13-20)21-14-8-18(3)9-15-21;2*1-2(3)4;/h4-15H,1-3H3;2*1H3,(H,3,4);/q;;;+2/p-2 |
| InChIKey | MFGVUPVBHUUSJR-UHFFFAOYSA-L |
| XLogP | 1.88 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 528.88 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze palladium(2+);tris(4-methylphenyl)phosphane;diacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of palladium(2+);tris(4-methylphenyl)phosphane;diacetate?
The IUPAC name of palladium(2+);tris(4-methylphenyl)phosphane;diacetate (CID 173264842) is palladium(2+);tris(4-methylphenyl)phosphane;diacetate.
What is the SMILES notation for palladium(2+);tris(4-methylphenyl)phosphane;diacetate?
The canonical SMILES for palladium(2+);tris(4-methylphenyl)phosphane;diacetate is CC(=O)[O-].CC(=O)[O-].Cc1ccc(P(c2ccc(C)cc2)c2ccc(C)cc2)cc1.[Pd+2].
What is the InChIKey of palladium(2+);tris(4-methylphenyl)phosphane;diacetate?
The InChIKey is MFGVUPVBHUUSJR-UHFFFAOYSA-L. The full InChI is InChI=1S/C21H21P.2C2H4O2.Pd/c1-16-4-10-19(11-5-16)22(20-12-6-17(2)7-13-20)21-14-8-18(3)9-15-21;2*1-2(3)4;/h4-15H,1-3H3;2*1H3,(H,3,4);/q;;;+2/p-2.
What are the key properties of palladium(2+);tris(4-methylphenyl)phosphane;diacetate?
palladium(2+);tris(4-methylphenyl)phosphane;diacetate has a molecular weight of 528.88 g/mol, XLogP of 1.88, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for palladium(2+);tris(4-methylphenyl)phosphane;diacetate is sourced from PubChem (CID 173264842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).