C12H12NO2S2+ — CID 3286691
2-[(3-prop-2-enyl-1,3-benzothiazol-3-ium-2-yl)sulfanyl]acetic acid (PubChem CID 3286691) has the molecular formula C12H12NO2S2+ and a molecular weight of 266.37 g/mol. Its IUPAC name is 2-[(3-prop-2-enyl-1,3-benzothiazol-3-ium-2-yl)sulfanyl]acetic acid.
| Compound Name | 2-[(3-prop-2-enyl-1,3-benzothiazol-3-ium-2-yl)sulfanyl]acetic acid |
|---|---|
| PubChem CID | 3286691 |
| Molecular Formula | C12H12NO2S2+ |
| Molecular Weight | 266.37 g/mol |
| Exact Mass | 266.03 |
| IUPAC Name | 2-[(3-prop-2-enyl-1,3-benzothiazol-3-ium-2-yl)sulfanyl]acetic acid |
| SMILES | C=CC[n+]1c(SCC(=O)O)sc2ccccc21 |
| InChI | InChI=1S/C12H11NO2S2/c1-2-7-13-9-5-3-4-6-10(9)17-12(13)16-8-11(14)15/h2-6H,1,7-8H2/p+1 |
| InChIKey | MXIZCMWCQJYAGI-UHFFFAOYSA-O |
| XLogP | 2.55 |
| TPSA | 41.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.37 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|