C11H11NO2S2 — CID 6944901
2-[(3-ethyl-1,3-benzothiazol-3-ium-2-yl)sulfanyl]acetate (PubChem CID 6944901) has the molecular formula C11H11NO2S2 and a molecular weight of 253.35 g/mol. Its IUPAC name is 2-[(3-ethyl-1,3-benzothiazol-3-ium-2-yl)sulfanyl]acetate.
| Compound Name | 2-[(3-ethyl-1,3-benzothiazol-3-ium-2-yl)sulfanyl]acetate |
|---|---|
| PubChem CID | 6944901 |
| Molecular Formula | C11H11NO2S2 |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.02 |
| IUPAC Name | 2-[(3-ethyl-1,3-benzothiazol-3-ium-2-yl)sulfanyl]acetate |
| SMILES | CC[n+]1c(SCC(=O)[O-])sc2ccccc21 |
| InChI | InChI=1S/C11H11NO2S2/c1-2-12-8-5-3-4-6-9(8)16-11(12)15-7-10(13)14/h3-6H,2,7H2,1H3 |
| InChIKey | LODPNIOQDOAZJE-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 44.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|