C28H36N2O8S5 — CID 139649483
bis(ethyl 2-methyl-2-[(3-methyl-1,3-benzothiazol-3-ium-2-yl)sulfanyl]propanoate);sulfate (PubChem CID 139649483) has the molecular formula C28H36N2O8S5 and a molecular weight of 688.94 g/mol. Its IUPAC name is bis(ethyl 2-methyl-2-[(3-methyl-1,3-benzothiazol-3-ium-2-yl)sulfanyl]propanoate);sulfate.
| Compound Name | bis(ethyl 2-methyl-2-[(3-methyl-1,3-benzothiazol-3-ium-2-yl)sulfanyl]propanoate);sulfate |
|---|---|
| PubChem CID | 139649483 |
| Molecular Formula | C28H36N2O8S5 |
| Molecular Weight | 688.94 g/mol |
| Exact Mass | 688.11 |
| IUPAC Name | bis(ethyl 2-methyl-2-[(3-methyl-1,3-benzothiazol-3-ium-2-yl)sulfanyl]propanoate);sulfate |
| SMILES | CCOC(=O)C(C)(C)Sc1sc2ccccc2[n+]1C.CCOC(=O)C(C)(C)Sc1sc2ccccc2[n+]1C.O=S(=O)([O-])[O-] |
| InChI | InChI=1S/2C14H18NO2S2.H2O4S/c2*1-5-17-12(16)14(2,3)19-13-15(4)10-8-6-7-9-11(10)18-13;1-5(2,3)4/h2*6-9H,5H2,1-4H3;(H2,1,2,3,4)/q2*+1;/p-2 |
| InChIKey | GVALCNBDXXCZSN-UHFFFAOYSA-L |
| XLogP | 4.98 |
| TPSA | 140.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.94 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|