C18H18NO2S2+ — CID 139649475
ethyl 2-[(3-methyl-1,3-benzothiazol-3-ium-2-yl)sulfanyl]-2-phenylacetate (PubChem CID 139649475) has the molecular formula C18H18NO2S2+ and a molecular weight of 344.48 g/mol. Its IUPAC name is ethyl 2-[(3-methyl-1,3-benzothiazol-3-ium-2-yl)sulfanyl]-2-phenylacetate.
| Compound Name | ethyl 2-[(3-methyl-1,3-benzothiazol-3-ium-2-yl)sulfanyl]-2-phenylacetate |
|---|---|
| PubChem CID | 139649475 |
| Molecular Formula | C18H18NO2S2+ |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | ethyl 2-[(3-methyl-1,3-benzothiazol-3-ium-2-yl)sulfanyl]-2-phenylacetate |
| SMILES | CCOC(=O)C(Sc1sc2ccccc2[n+]1C)c1ccccc1 |
| InChI | InChI=1S/C18H18NO2S2/c1-3-21-17(20)16(13-9-5-4-6-10-13)23-18-19(2)14-11-7-8-12-15(14)22-18/h4-12,16H,3H2,1-2H3/q+1 |
| InChIKey | FHTDPSFKNPAJOE-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|