C21H18NS2+ — CID 139649482
2-benzhydrylsulfanyl-3-methyl-1,3-benzothiazol-3-ium (PubChem CID 139649482) has the molecular formula C21H18NS2+ and a molecular weight of 348.52 g/mol. Its IUPAC name is 2-benzhydrylsulfanyl-3-methyl-1,3-benzothiazol-3-ium.
| Compound Name | 2-benzhydrylsulfanyl-3-methyl-1,3-benzothiazol-3-ium |
|---|---|
| PubChem CID | 139649482 |
| Molecular Formula | C21H18NS2+ |
| Molecular Weight | 348.52 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | 2-benzhydrylsulfanyl-3-methyl-1,3-benzothiazol-3-ium |
| SMILES | C[n+]1c(SC(c2ccccc2)c2ccccc2)sc2ccccc21 |
| InChI | InChI=1S/C21H18NS2/c1-22-18-14-8-9-15-19(18)23-21(22)24-20(16-10-4-2-5-11-16)17-12-6-3-7-13-17/h2-15,20H,1H3/q+1 |
| InChIKey | HACLJZYDBCTQJQ-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.52 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|