C15H13N2O2S2+ — CID 139649479
3-methyl-2-[(2-nitrophenyl)methylsulfanyl]-1,3-benzothiazol-3-ium (PubChem CID 139649479) has the molecular formula C15H13N2O2S2+ and a molecular weight of 317.42 g/mol. Its IUPAC name is 3-methyl-2-[(2-nitrophenyl)methylsulfanyl]-1,3-benzothiazol-3-ium.
| Compound Name | 3-methyl-2-[(2-nitrophenyl)methylsulfanyl]-1,3-benzothiazol-3-ium |
|---|---|
| PubChem CID | 139649479 |
| Molecular Formula | C15H13N2O2S2+ |
| Molecular Weight | 317.42 g/mol |
| Exact Mass | 317.04 |
| IUPAC Name | 3-methyl-2-[(2-nitrophenyl)methylsulfanyl]-1,3-benzothiazol-3-ium |
| SMILES | C[n+]1c(SCc2ccccc2[N+](=O)[O-])sc2ccccc21 |
| InChI | InChI=1S/C15H13N2O2S2/c1-16-13-8-4-5-9-14(13)21-15(16)20-10-11-6-2-3-7-12(11)17(18)19/h2-9H,10H2,1H3/q+1 |
| InChIKey | GPNBOAPHIDUULO-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 47.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.42 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|