C17H10ClN3O3S2 — CID 7940622
2-(3-chloro-1-benzothiophen-2-yl)-5-[(2-nitrophenyl)methylsulfanyl]-1,3,4-oxadiazole (PubChem CID 7940622) has the molecular formula C17H10ClN3O3S2 and a molecular weight of 403.87 g/mol. Its IUPAC name is 2-(3-chloro-1-benzothiophen-2-yl)-5-[(2-nitrophenyl)methylsulfanyl]-1,3,4-oxadiazole.
| Compound Name | 2-(3-chloro-1-benzothiophen-2-yl)-5-[(2-nitrophenyl)methylsulfanyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 7940622 |
| Molecular Formula | C17H10ClN3O3S2 |
| Molecular Weight | 403.87 g/mol |
| Exact Mass | 402.99 |
| IUPAC Name | 2-(3-chloro-1-benzothiophen-2-yl)-5-[(2-nitrophenyl)methylsulfanyl]-1,3,4-oxadiazole |
| SMILES | O=[N+]([O-])c1ccccc1CSc1nnc(-c2sc3ccccc3c2Cl)o1 |
| InChI | InChI=1S/C17H10ClN3O3S2/c18-14-11-6-2-4-8-13(11)26-15(14)16-19-20-17(24-16)25-9-10-5-1-3-7-12(10)21(22)23/h1-8H,9H2 |
| InChIKey | WHNYKIBXQQHGMS-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 82.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.87 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|