C13H11ClN2OS3 — CID 7875900
2-(3-chloro-1-benzothiophen-2-yl)-5-(2-methylsulfanylethylsulfanyl)-1,3,4-oxadiazole (PubChem CID 7875900) has the molecular formula C13H11ClN2OS3 and a molecular weight of 342.90 g/mol. Its IUPAC name is 2-(3-chloro-1-benzothiophen-2-yl)-5-(2-methylsulfanylethylsulfanyl)-1,3,4-oxadiazole.
| Compound Name | 2-(3-chloro-1-benzothiophen-2-yl)-5-(2-methylsulfanylethylsulfanyl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 7875900 |
| Molecular Formula | C13H11ClN2OS3 |
| Molecular Weight | 342.90 g/mol |
| Exact Mass | 341.97 |
| IUPAC Name | 2-(3-chloro-1-benzothiophen-2-yl)-5-(2-methylsulfanylethylsulfanyl)-1,3,4-oxadiazole |
| SMILES | CSCCSc1nnc(-c2sc3ccccc3c2Cl)o1 |
| InChI | InChI=1S/C13H11ClN2OS3/c1-18-6-7-19-13-16-15-12(17-13)11-10(14)8-4-2-3-5-9(8)20-11/h2-5H,6-7H2,1H3 |
| InChIKey | LHBMSKVMNSCOGI-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.90 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|