C18H13ClN2O2S2 — CID 7940623
2-(3-chloro-1-benzothiophen-2-yl)-5-(2-phenoxyethylsulfanyl)-1,3,4-oxadiazole (PubChem CID 7940623) has the molecular formula C18H13ClN2O2S2 and a molecular weight of 388.90 g/mol. Its IUPAC name is 2-(3-chloro-1-benzothiophen-2-yl)-5-(2-phenoxyethylsulfanyl)-1,3,4-oxadiazole.
| Compound Name | 2-(3-chloro-1-benzothiophen-2-yl)-5-(2-phenoxyethylsulfanyl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 7940623 |
| Molecular Formula | C18H13ClN2O2S2 |
| Molecular Weight | 388.90 g/mol |
| Exact Mass | 388.01 |
| IUPAC Name | 2-(3-chloro-1-benzothiophen-2-yl)-5-(2-phenoxyethylsulfanyl)-1,3,4-oxadiazole |
| SMILES | Clc1c(-c2nnc(SCCOc3ccccc3)o2)sc2ccccc12 |
| InChI | InChI=1S/C18H13ClN2O2S2/c19-15-13-8-4-5-9-14(13)25-16(15)17-20-21-18(23-17)24-11-10-22-12-6-2-1-3-7-12/h1-9H,10-11H2 |
| InChIKey | XPFVASPHNZCFOZ-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.90 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|