C11H11N2O2S2+ — CID 52904067
6-methylsulfonyl-3-prop-2-ynyl-1,3-benzothiazol-3-ium-2-amine (PubChem CID 52904067) has the molecular formula C11H11N2O2S2+ and a molecular weight of 267.35 g/mol. Its IUPAC name is 6-methylsulfonyl-3-prop-2-ynyl-1,3-benzothiazol-3-ium-2-amine.
| Compound Name | 6-methylsulfonyl-3-prop-2-ynyl-1,3-benzothiazol-3-ium-2-amine |
|---|---|
| PubChem CID | 52904067 |
| Molecular Formula | C11H11N2O2S2+ |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.03 |
| IUPAC Name | 6-methylsulfonyl-3-prop-2-ynyl-1,3-benzothiazol-3-ium-2-amine |
| SMILES | C#CC[n+]1c(N)sc2cc(S(C)(=O)=O)ccc21 |
| InChI | InChI=1S/C11H10N2O2S2/c1-3-6-13-9-5-4-8(17(2,14)15)7-10(9)16-11(13)12/h1,4-5,7,12H,6H2,2H3/p+1 |
| InChIKey | OLXFLPLAILCEPR-UHFFFAOYSA-O |
| XLogP | 0.81 |
| TPSA | 64.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|