C10H12NO2S3+ — CID 20605146
3-methyl-2-methylsulfanyl-6-methylsulfonyl-1,3-benzothiazol-3-ium (PubChem CID 20605146) has the molecular formula C10H12NO2S3+ and a molecular weight of 274.41 g/mol. Its IUPAC name is 3-methyl-2-methylsulfanyl-6-methylsulfonyl-1,3-benzothiazol-3-ium.
| Compound Name | 3-methyl-2-methylsulfanyl-6-methylsulfonyl-1,3-benzothiazol-3-ium |
|---|---|
| PubChem CID | 20605146 |
| Molecular Formula | C10H12NO2S3+ |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.00 |
| IUPAC Name | 3-methyl-2-methylsulfanyl-6-methylsulfonyl-1,3-benzothiazol-3-ium |
| SMILES | CSc1sc2cc(S(C)(=O)=O)ccc2[n+]1C |
| InChI | InChI=1S/C10H12NO2S3/c1-11-8-5-4-7(16(3,12)13)6-9(8)15-10(11)14-2/h4-6H,1-3H3/q+1 |
| InChIKey | WQSHPWHQQDOUSW-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 38.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|