C16H16ClNO3S3 — CID 86745614
5-chloro-3-methyl-2-methylsulfanyl-1,3-benzothiazol-3-ium;4-methylbenzenesulfonate (PubChem CID 86745614) has the molecular formula C16H16ClNO3S3 and a molecular weight of 401.96 g/mol. Its IUPAC name is 5-chloro-3-methyl-2-methylsulfanyl-1,3-benzothiazol-3-ium;4-methylbenzenesulfonate.
| Compound Name | 5-chloro-3-methyl-2-methylsulfanyl-1,3-benzothiazol-3-ium;4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 86745614 |
| Molecular Formula | C16H16ClNO3S3 |
| Molecular Weight | 401.96 g/mol |
| Exact Mass | 401.00 |
| IUPAC Name | 5-chloro-3-methyl-2-methylsulfanyl-1,3-benzothiazol-3-ium;4-methylbenzenesulfonate |
| SMILES | CSc1sc2ccc(Cl)cc2[n+]1C.Cc1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C9H9ClNS2.C7H8O3S/c1-11-7-5-6(10)3-4-8(7)13-9(11)12-2;1-6-2-4-7(5-3-6)11(8,9)10/h3-5H,1-2H3;2-5H,1H3,(H,8,9,10)/q+1;/p-1 |
| InChIKey | AQXSKUKYJFBTBT-UHFFFAOYSA-M |
| XLogP | 4.00 |
| TPSA | 61.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.96 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|