C18H18ClNO4S — CID 177370437
6-chloro-1,2-dimethylquinolin-1-ium;4-methoxybenzenesulfonate (PubChem CID 177370437) has the molecular formula C18H18ClNO4S and a molecular weight of 379.87 g/mol. Its IUPAC name is 6-chloro-1,2-dimethylquinolin-1-ium;4-methoxybenzenesulfonate.
| Compound Name | 6-chloro-1,2-dimethylquinolin-1-ium;4-methoxybenzenesulfonate |
|---|---|
| PubChem CID | 177370437 |
| Molecular Formula | C18H18ClNO4S |
| Molecular Weight | 379.87 g/mol |
| Exact Mass | 379.06 |
| IUPAC Name | 6-chloro-1,2-dimethylquinolin-1-ium;4-methoxybenzenesulfonate |
| SMILES | COc1ccc(S(=O)(=O)[O-])cc1.Cc1ccc2cc(Cl)ccc2[n+]1C |
| InChI | InChI=1S/C11H11ClN.C7H8O4S/c1-8-3-4-9-7-10(12)5-6-11(9)13(8)2;1-11-6-2-4-7(5-3-6)12(8,9)10/h3-7H,1-2H3;2-5H,1H3,(H,8,9,10)/q+1;/p-1 |
| InChIKey | FFECBJFPVNIVDD-UHFFFAOYSA-M |
| XLogP | 3.23 |
| TPSA | 70.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.87 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|