C35H41ClFN5O3S+2 — CID 71210642
N-[2-[(6-chloro-1,2-dimethylquinolin-1-ium-4-yl)amino]ethyl]-N-[4-[(6-fluoro-1,2-dimethylquinolin-1-ium-4-yl)amino]butyl]-4-methoxybenzenesulfonamide (PubChem CID 71210642) has the molecular formula C35H41ClFN5O3S+2 and a molecular weight of 666.26 g/mol. Its IUPAC name is N-[2-[(6-chloro-1,2-dimethylquinolin-1-ium-4-yl)amino]ethyl]-N-[4-[(6-fluoro-1,2-dimethylquinolin-1-ium-4-yl)amino]butyl]-4-methoxybenzenesulfonamide.
| Compound Name | N-[2-[(6-chloro-1,2-dimethylquinolin-1-ium-4-yl)amino]ethyl]-N-[4-[(6-fluoro-1,2-dimethylquinolin-1-ium-4-yl)amino]butyl]-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 71210642 |
| Molecular Formula | C35H41ClFN5O3S+2 |
| Molecular Weight | 666.26 g/mol |
| Exact Mass | 665.26 |
| IUPAC Name | N-[2-[(6-chloro-1,2-dimethylquinolin-1-ium-4-yl)amino]ethyl]-N-[4-[(6-fluoro-1,2-dimethylquinolin-1-ium-4-yl)amino]butyl]-4-methoxybenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)N(CCCCNc2cc(C)[n+](C)c3ccc(F)cc23)CCNc2cc(C)[n+](C)c3ccc(Cl)cc23)cc1 |
| InChI | InChI=1S/C35H39ClFN5O3S/c1-24-20-32(30-22-26(36)8-14-34(30)40(24)3)39-17-19-42(46(43,44)29-12-10-28(45-5)11-13-29)18-7-6-16-38-33-21-25(2)41(4)35-15-9-27(37)23-31(33)35/h8-15,20-23H,6-7,16-19H2,1-5H3/p+2 |
| InChIKey | HHEULXGCLCEOFX-UHFFFAOYSA-P |
| XLogP | 6.06 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.26 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|