C32H34ClN5O9S — CID 11296998
2-[2-[3-[2-[(6-chloro-2-methylquinolin-4-yl)amino]ethyl-(4-methoxyphenyl)sulfonylamino]propanoylamino]-5-nitrophenoxy]ethyl acetate (PubChem CID 11296998) has the molecular formula C32H34ClN5O9S and a molecular weight of 700.17 g/mol. Its IUPAC name is 2-[2-[3-[2-[(6-chloro-2-methylquinolin-4-yl)amino]ethyl-(4-methoxyphenyl)sulfonylamino]propanoylamino]-5-nitrophenoxy]ethyl acetate.
| Compound Name | 2-[2-[3-[2-[(6-chloro-2-methylquinolin-4-yl)amino]ethyl-(4-methoxyphenyl)sulfonylamino]propanoylamino]-5-nitrophenoxy]ethyl acetate |
|---|---|
| PubChem CID | 11296998 |
| Molecular Formula | C32H34ClN5O9S |
| Molecular Weight | 700.17 g/mol |
| Exact Mass | 699.18 |
| IUPAC Name | 2-[2-[3-[2-[(6-chloro-2-methylquinolin-4-yl)amino]ethyl-(4-methoxyphenyl)sulfonylamino]propanoylamino]-5-nitrophenoxy]ethyl acetate |
| SMILES | COc1ccc(S(=O)(=O)N(CCNc2cc(C)nc3ccc(Cl)cc23)CCC(=O)Nc2ccc([N+](=O)[O-])cc2OCCOC(C)=O)cc1 |
| InChI | InChI=1S/C32H34ClN5O9S/c1-21-18-30(27-19-23(33)4-10-28(27)35-21)34-13-15-37(48(43,44)26-8-6-25(45-3)7-9-26)14-12-32(40)36-29-11-5-24(38(41)42)20-31(29)47-17-16-46-22(2)39/h4-11,18-20H,12-17H2,1-3H3,(H,34,35)(H,36,40) |
| InChIKey | KWANDLXYJDTZQP-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 179.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.17 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|