C39H36ClN5O7S — CID 11274214
3-[2-[(6-chloro-2-methylquinolin-4-yl)amino]ethyl-(4-methoxyphenyl)sulfonylamino]-N-[2-(naphthalen-2-ylmethoxy)-4-nitrophenyl]propanamide (PubChem CID 11274214) has the molecular formula C39H36ClN5O7S and a molecular weight of 754.27 g/mol. Its IUPAC name is 3-[2-[(6-chloro-2-methylquinolin-4-yl)amino]ethyl-(4-methoxyphenyl)sulfonylamino]-N-[2-(naphthalen-2-ylmethoxy)-4-nitrophenyl]propanamide.
| Compound Name | 3-[2-[(6-chloro-2-methylquinolin-4-yl)amino]ethyl-(4-methoxyphenyl)sulfonylamino]-N-[2-(naphthalen-2-ylmethoxy)-4-nitrophenyl]propanamide |
|---|---|
| PubChem CID | 11274214 |
| Molecular Formula | C39H36ClN5O7S |
| Molecular Weight | 754.27 g/mol |
| Exact Mass | 753.20 |
| IUPAC Name | 3-[2-[(6-chloro-2-methylquinolin-4-yl)amino]ethyl-(4-methoxyphenyl)sulfonylamino]-N-[2-(naphthalen-2-ylmethoxy)-4-nitrophenyl]propanamide |
| SMILES | COc1ccc(S(=O)(=O)N(CCNc2cc(C)nc3ccc(Cl)cc23)CCC(=O)Nc2ccc([N+](=O)[O-])cc2OCc2ccc3ccccc3c2)cc1 |
| InChI | InChI=1S/C39H36ClN5O7S/c1-26-21-37(34-23-30(40)9-15-35(34)42-26)41-18-20-44(53(49,50)33-13-11-32(51-2)12-14-33)19-17-39(46)43-36-16-10-31(45(47)48)24-38(36)52-25-27-7-8-28-5-3-4-6-29(28)22-27/h3-16,21-24H,17-20,25H2,1-2H3,(H,41,42)(H,43,46) |
| InChIKey | DIEPOFMKLJYNSH-UHFFFAOYSA-N |
| XLogP | 7.98 |
| TPSA | 153.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.27 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|