C35H34ClN5O7S — CID 11456771
3-[2-[(6-chloro-2-methylquinolin-4-yl)amino]ethyl-(4-methoxyphenyl)sulfonylamino]-N-(4-nitro-2-phenylmethoxyphenyl)propanamide (PubChem CID 11456771) has the molecular formula C35H34ClN5O7S and a molecular weight of 704.21 g/mol. Its IUPAC name is 3-[2-[(6-chloro-2-methylquinolin-4-yl)amino]ethyl-(4-methoxyphenyl)sulfonylamino]-N-(4-nitro-2-phenylmethoxyphenyl)propanamide.
| Compound Name | 3-[2-[(6-chloro-2-methylquinolin-4-yl)amino]ethyl-(4-methoxyphenyl)sulfonylamino]-N-(4-nitro-2-phenylmethoxyphenyl)propanamide |
|---|---|
| PubChem CID | 11456771 |
| Molecular Formula | C35H34ClN5O7S |
| Molecular Weight | 704.21 g/mol |
| Exact Mass | 703.19 |
| IUPAC Name | 3-[2-[(6-chloro-2-methylquinolin-4-yl)amino]ethyl-(4-methoxyphenyl)sulfonylamino]-N-(4-nitro-2-phenylmethoxyphenyl)propanamide |
| SMILES | COc1ccc(S(=O)(=O)N(CCNc2cc(C)nc3ccc(Cl)cc23)CCC(=O)Nc2ccc([N+](=O)[O-])cc2OCc2ccccc2)cc1 |
| InChI | InChI=1S/C35H34ClN5O7S/c1-24-20-33(30-21-26(36)8-14-31(30)38-24)37-17-19-40(49(45,46)29-12-10-28(47-2)11-13-29)18-16-35(42)39-32-15-9-27(41(43)44)22-34(32)48-23-25-6-4-3-5-7-25/h3-15,20-22H,16-19,23H2,1-2H3,(H,37,38)(H,39,42) |
| InChIKey | WQKDXWGRZVVENA-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 153.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.21 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|