C37H47N5O3S+2 — CID 58807160
4-methoxy-N,N-bis[3-[(1,2,6-trimethylquinolin-1-ium-4-yl)amino]propyl]benzenesulfonamide (PubChem CID 58807160) has the molecular formula C37H47N5O3S+2 and a molecular weight of 641.88 g/mol. Its IUPAC name is 4-methoxy-N,N-bis[3-[(1,2,6-trimethylquinolin-1-ium-4-yl)amino]propyl]benzenesulfonamide.
| Compound Name | 4-methoxy-N,N-bis[3-[(1,2,6-trimethylquinolin-1-ium-4-yl)amino]propyl]benzenesulfonamide |
|---|---|
| PubChem CID | 58807160 |
| Molecular Formula | C37H47N5O3S+2 |
| Molecular Weight | 641.88 g/mol |
| Exact Mass | 641.34 |
| IUPAC Name | 4-methoxy-N,N-bis[3-[(1,2,6-trimethylquinolin-1-ium-4-yl)amino]propyl]benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)N(CCCNc2cc(C)[n+](C)c3ccc(C)cc23)CCCNc2cc(C)[n+](C)c3ccc(C)cc23)cc1 |
| InChI | InChI=1S/C37H45N5O3S/c1-26-10-16-36-32(22-26)34(24-28(3)40(36)5)38-18-8-20-42(46(43,44)31-14-12-30(45-7)13-15-31)21-9-19-39-35-25-29(4)41(6)37-17-11-27(2)23-33(35)37/h10-17,22-25H,8-9,18-21H2,1-7H3/p+2 |
| InChIKey | DVSHDNYBKINAJS-UHFFFAOYSA-P |
| XLogP | 5.88 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.88 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|