C27H32N4O — CID 11407724
N-(2,6-dimethylquinolin-4-yl)-N'-(6-methoxy-2-methylquinolin-4-yl)pentane-1,5-diamine (PubChem CID 11407724) has the molecular formula C27H32N4O and a molecular weight of 428.58 g/mol. Its IUPAC name is N-(2,6-dimethylquinolin-4-yl)-N'-(6-methoxy-2-methylquinolin-4-yl)pentane-1,5-diamine.
| Compound Name | N-(2,6-dimethylquinolin-4-yl)-N'-(6-methoxy-2-methylquinolin-4-yl)pentane-1,5-diamine |
|---|---|
| PubChem CID | 11407724 |
| Molecular Formula | C27H32N4O |
| Molecular Weight | 428.58 g/mol |
| Exact Mass | 428.26 |
| IUPAC Name | N-(2,6-dimethylquinolin-4-yl)-N'-(6-methoxy-2-methylquinolin-4-yl)pentane-1,5-diamine |
| SMILES | COc1ccc2nc(C)cc(NCCCCCNc3cc(C)nc4ccc(C)cc34)c2c1 |
| InChI | InChI=1S/C27H32N4O/c1-18-8-10-24-22(14-18)26(15-19(2)30-24)28-12-6-5-7-13-29-27-16-20(3)31-25-11-9-21(32-4)17-23(25)27/h8-11,14-17H,5-7,12-13H2,1-4H3,(H,28,30)(H,29,31) |
| InChIKey | MSPVAUHVMJANND-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 59.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.58 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|