C19H29N3O — CID 169487817
N-(6-ethoxy-2-methylquinolin-4-yl)-N',N'-diethylpropane-1,3-diamine (PubChem CID 169487817) has the molecular formula C19H29N3O and a molecular weight of 315.46 g/mol. Its IUPAC name is N-(6-ethoxy-2-methylquinolin-4-yl)-N',N'-diethylpropane-1,3-diamine.
| Compound Name | N-(6-ethoxy-2-methylquinolin-4-yl)-N',N'-diethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 169487817 |
| Molecular Formula | C19H29N3O |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.23 |
| IUPAC Name | N-(6-ethoxy-2-methylquinolin-4-yl)-N',N'-diethylpropane-1,3-diamine |
| SMILES | CCOc1ccc2nc(C)cc(NCCCN(CC)CC)c2c1 |
| InChI | InChI=1S/C19H29N3O/c1-5-22(6-2)12-8-11-20-19-13-15(4)21-18-10-9-16(23-7-3)14-17(18)19/h9-10,13-14H,5-8,11-12H2,1-4H3,(H,20,21) |
| InChIKey | QXNXHSSEHWCBOH-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|