C22H29N5O — CID 46938137
N',N'-diethyl-N-[4-methyl-6-(2-methylquinolin-6-yl)oxypyrimidin-2-yl]propane-1,3-diamine (PubChem CID 46938137) has the molecular formula C22H29N5O and a molecular weight of 379.51 g/mol. Its IUPAC name is N',N'-diethyl-N-[4-methyl-6-(2-methylquinolin-6-yl)oxypyrimidin-2-yl]propane-1,3-diamine.
| Compound Name | N',N'-diethyl-N-[4-methyl-6-(2-methylquinolin-6-yl)oxypyrimidin-2-yl]propane-1,3-diamine |
|---|---|
| PubChem CID | 46938137 |
| Molecular Formula | C22H29N5O |
| Molecular Weight | 379.51 g/mol |
| Exact Mass | 379.24 |
| IUPAC Name | N',N'-diethyl-N-[4-methyl-6-(2-methylquinolin-6-yl)oxypyrimidin-2-yl]propane-1,3-diamine |
| SMILES | CCN(CC)CCCNc1nc(C)cc(Oc2ccc3nc(C)ccc3c2)n1 |
| InChI | InChI=1S/C22H29N5O/c1-5-27(6-2)13-7-12-23-22-25-17(4)14-21(26-22)28-19-10-11-20-18(15-19)9-8-16(3)24-20/h8-11,14-15H,5-7,12-13H2,1-4H3,(H,23,25,26) |
| InChIKey | CBYGXRLQLUJSCS-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 63.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.51 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|