C20H26N2S+2 — CID 18331025
trimethyl-[3-(2-methyl-5-phenyl-1,3-benzothiazol-3-ium-3-yl)propyl]azanium (PubChem CID 18331025) has the molecular formula C20H26N2S+2 and a molecular weight of 326.51 g/mol. Its IUPAC name is trimethyl-[3-(2-methyl-5-phenyl-1,3-benzothiazol-3-ium-3-yl)propyl]azanium.
| Compound Name | trimethyl-[3-(2-methyl-5-phenyl-1,3-benzothiazol-3-ium-3-yl)propyl]azanium |
|---|---|
| PubChem CID | 18331025 |
| Molecular Formula | C20H26N2S+2 |
| Molecular Weight | 326.51 g/mol |
| Exact Mass | 326.18 |
| IUPAC Name | trimethyl-[3-(2-methyl-5-phenyl-1,3-benzothiazol-3-ium-3-yl)propyl]azanium |
| SMILES | Cc1sc2ccc(-c3ccccc3)cc2[n+]1CCC[N+](C)(C)C |
| InChI | InChI=1S/C20H26N2S/c1-16-21(13-8-14-22(2,3)4)19-15-18(11-12-20(19)23-16)17-9-6-5-7-10-17/h5-7,9-12,15H,8,13-14H2,1-4H3/q+2 |
| InChIKey | SQELUNWEEWYNNG-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.51 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|