C14H14INS2 — CID 13216392
3-ethyl-2-methyl-5-phenylthieno[2,3-d][1,3]thiazol-3-ium iodide (PubChem CID 13216392) has the molecular formula C14H14INS2 and a molecular weight of 387.31 g/mol. Its IUPAC name is 3-ethyl-2-methyl-5-phenylthieno[2,3-d][1,3]thiazol-3-ium iodide.
| Compound Name | 3-ethyl-2-methyl-5-phenylthieno[2,3-d][1,3]thiazol-3-ium iodide |
|---|---|
| PubChem CID | 13216392 |
| Molecular Formula | C14H14INS2 |
| Molecular Weight | 387.31 g/mol |
| Exact Mass | 386.96 |
| IUPAC Name | 3-ethyl-2-methyl-5-phenylthieno[2,3-d][1,3]thiazol-3-ium iodide |
| SMILES | CC[n+]1c(C)sc2cc(-c3ccccc3)sc21.[I-] |
| InChI | InChI=1S/C14H14NS2.HI/c1-3-15-10(2)16-13-9-12(17-14(13)15)11-7-5-4-6-8-11;/h4-9H,3H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | VPKNZWGVTMSTDF-UHFFFAOYSA-M |
| XLogP | 1.25 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.31 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|