C14H14ClNS — CID 163329939
3-ethyl-2-methylbenzo[g][1,3]benzothiazol-3-ium chloride (PubChem CID 163329939) has the molecular formula C14H14ClNS and a molecular weight of 263.79 g/mol. Its IUPAC name is 3-ethyl-2-methylbenzo[g][1,3]benzothiazol-3-ium chloride.
| Compound Name | 3-ethyl-2-methylbenzo[g][1,3]benzothiazol-3-ium chloride |
|---|---|
| PubChem CID | 163329939 |
| Molecular Formula | C14H14ClNS |
| Molecular Weight | 263.79 g/mol |
| Exact Mass | 263.05 |
| IUPAC Name | 3-ethyl-2-methylbenzo[g][1,3]benzothiazol-3-ium chloride |
| SMILES | CC[n+]1c(C)sc2c3ccccc3ccc21.[Cl-] |
| InChI | InChI=1S/C14H14NS.ClH/c1-3-15-10(2)16-14-12-7-5-4-6-11(12)8-9-13(14)15;/h4-9H,3H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | QVRZGJZNNIMCKE-UHFFFAOYSA-M |
| XLogP | 0.67 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.79 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|