3-ethyl-2-methylbenzo[g][1,3]benzothiazol-3-ium chloride

C14H14ClNS — CID 163329939

IUPAC3-ethyl-2-methylbenzo[g][1,3]benzothiazol-3-ium chloride
SMILESCC[n+]1c(C)sc2c3ccccc3ccc21.[Cl-]
InChIInChI=1S/C14H14NS.ClH/c1-3-15-10(2)16-14-12-7-5-4-6-11(12)8-9-13(14)15;/h4-9H,3H2,1-2H3;1H/q+1;/p-1
InChIKeyQVRZGJZNNIMCKE-UHFFFAOYSA-M
MW263.79 g/mol
LogP0.67
Rot. Bonds1

About 3-ethyl-2-methylbenzo[g][1,3]benzothiazol-3-ium chloride

3-ethyl-2-methylbenzo[g][1,3]benzothiazol-3-ium chloride (PubChem CID 163329939) has the molecular formula C14H14ClNS and a molecular weight of 263.79 g/mol. Its IUPAC name is 3-ethyl-2-methylbenzo[g][1,3]benzothiazol-3-ium chloride.

Molecular Properties

Compound Name3-ethyl-2-methylbenzo[g][1,3]benzothiazol-3-ium chloride
PubChem CID163329939
Molecular FormulaC14H14ClNS
Molecular Weight263.79 g/mol
Exact Mass263.05
IUPAC Name3-ethyl-2-methylbenzo[g][1,3]benzothiazol-3-ium chloride
SMILESCC[n+]1c(C)sc2c3ccccc3ccc21.[Cl-]
InChIInChI=1S/C14H14NS.ClH/c1-3-15-10(2)16-14-12-7-5-4-6-11(12)8-9-13(14)15;/h4-9H,3H2,1-2H3;1H/q+1;/p-1
InChIKeyQVRZGJZNNIMCKE-UHFFFAOYSA-M
XLogP0.67
TPSA3.88 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds1
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500263.79
LogP ≤ 50.67
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}

Analyze 3-ethyl-2-methylbenzo[g][1,3]benzothiazol-3-ium chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-ethyl-2-methylbenzo[g][1,3]benzothiazol-3-ium chloride?
The IUPAC name of 3-ethyl-2-methylbenzo[g][1,3]benzothiazol-3-ium chloride (CID 163329939) is 3-ethyl-2-methylbenzo[g][1,3]benzothiazol-3-ium chloride.
What is the SMILES notation for 3-ethyl-2-methylbenzo[g][1,3]benzothiazol-3-ium chloride?
The canonical SMILES for 3-ethyl-2-methylbenzo[g][1,3]benzothiazol-3-ium chloride is CC[n+]1c(C)sc2c3ccccc3ccc21.[Cl-].
What is the InChIKey of 3-ethyl-2-methylbenzo[g][1,3]benzothiazol-3-ium chloride?
The InChIKey is QVRZGJZNNIMCKE-UHFFFAOYSA-M. The full InChI is InChI=1S/C14H14NS.ClH/c1-3-15-10(2)16-14-12-7-5-4-6-11(12)8-9-13(14)15;/h4-9H,3H2,1-2H3;1H/q+1;/p-1.
What are the key properties of 3-ethyl-2-methylbenzo[g][1,3]benzothiazol-3-ium chloride?
3-ethyl-2-methylbenzo[g][1,3]benzothiazol-3-ium chloride has a molecular weight of 263.79 g/mol, XLogP of 0.67, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-2-methylbenzo[g][1,3]benzothiazol-3-ium chloride is sourced from PubChem (CID 163329939), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).