C30H25N2S+ — CID 70942833
2-[[(3Z)-3-benzylidene-1-methylindol-2-ylidene]methyl]-3-ethylbenzo[g][1,3]benzothiazol-3-ium (PubChem CID 70942833) has the molecular formula C30H25N2S+ and a molecular weight of 445.61 g/mol. Its IUPAC name is 2-[[(3Z)-3-benzylidene-1-methylindol-2-ylidene]methyl]-3-ethylbenzo[g][1,3]benzothiazol-3-ium.
| Compound Name | 2-[[(3Z)-3-benzylidene-1-methylindol-2-ylidene]methyl]-3-ethylbenzo[g][1,3]benzothiazol-3-ium |
|---|---|
| PubChem CID | 70942833 |
| Molecular Formula | C30H25N2S+ |
| Molecular Weight | 445.61 g/mol |
| Exact Mass | 445.17 |
| IUPAC Name | 2-[[(3Z)-3-benzylidene-1-methylindol-2-ylidene]methyl]-3-ethylbenzo[g][1,3]benzothiazol-3-ium |
| SMILES | CC[n+]1c(C=c2/c(=C\c3ccccc3)c3ccccc3n2C)sc2c3ccccc3ccc21 |
| InChI | InChI=1S/C30H25N2S/c1-3-32-27-18-17-22-13-7-8-14-23(22)30(27)33-29(32)20-28-25(19-21-11-5-4-6-12-21)24-15-9-10-16-26(24)31(28)2/h4-20H,3H2,1-2H3/q+1/b25-19- |
| InChIKey | QRKYOGRNEODBMY-PLRJNAJWSA-N |
| XLogP | 5.51 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.61 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|