C40H55N2O2S2+ — CID 158357867
4-[(3-decylbenzo[g][1,3]benzothiazol-3-ium-2-yl)methylidene]-2-[(E)-(3-decyl-1,3-thiazolidin-2-ylidene)methyl]-3-hydroxycyclobut-2-en-1-one (PubChem CID 158357867) has the molecular formula C40H55N2O2S2+ and a molecular weight of 660.03 g/mol. Its IUPAC name is 4-[(3-decylbenzo[g][1,3]benzothiazol-3-ium-2-yl)methylidene]-2-[(E)-(3-decyl-1,3-thiazolidin-2-ylidene)methyl]-3-hydroxycyclobut-2-en-1-one.
| Compound Name | 4-[(3-decylbenzo[g][1,3]benzothiazol-3-ium-2-yl)methylidene]-2-[(E)-(3-decyl-1,3-thiazolidin-2-ylidene)methyl]-3-hydroxycyclobut-2-en-1-one |
|---|---|
| PubChem CID | 158357867 |
| Molecular Formula | C40H55N2O2S2+ |
| Molecular Weight | 660.03 g/mol |
| Exact Mass | 659.37 |
| IUPAC Name | 4-[(3-decylbenzo[g][1,3]benzothiazol-3-ium-2-yl)methylidene]-2-[(E)-(3-decyl-1,3-thiazolidin-2-ylidene)methyl]-3-hydroxycyclobut-2-en-1-one |
| SMILES | CCCCCCCCCCN1CCS/C1=C/C1=C(O)C(=Cc2sc3c4ccccc4ccc3[n+]2CCCCCCCCCC)C1=O |
| InChI | InChI=1S/C40H54N2O2S2/c1-3-5-7-9-11-13-15-19-25-41-27-28-45-36(41)29-33-38(43)34(39(33)44)30-37-42(26-20-16-14-12-10-8-6-4-2)35-24-23-31-21-17-18-22-32(31)40(35)46-37/h17-18,21-24,29-30H,3-16,19-20,25-28H2,1-2H3/p+1 |
| InChIKey | OXCSKPGDGNQWGI-UHFFFAOYSA-O |
| XLogP | 11.29 |
| TPSA | 44.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.03 |
| LogP ≤ 5 | 11.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|