C44H61N2O5S+ — CID 157094116
2-[(E)-[3-decyl-5-(hydroxymethyl)-1,3-benzoxazol-2-ylidene]methyl]-4-[(3-decyl-6-propan-2-yloxy-1,3-benzothiazol-3-ium-2-yl)methylidene]-3-hydroxycyclobut-2-en-1-one (PubChem CID 157094116) has the molecular formula C44H61N2O5S+ and a molecular weight of 730.05 g/mol. Its IUPAC name is 2-[(E)-[3-decyl-5-(hydroxymethyl)-1,3-benzoxazol-2-ylidene]methyl]-4-[(3-decyl-6-propan-2-yloxy-1,3-benzothiazol-3-ium-2-yl)methylidene]-3-hydroxycyclobut-2-en-1-one.
| Compound Name | 2-[(E)-[3-decyl-5-(hydroxymethyl)-1,3-benzoxazol-2-ylidene]methyl]-4-[(3-decyl-6-propan-2-yloxy-1,3-benzothiazol-3-ium-2-yl)methylidene]-3-hydroxycyclobut-2-en-1-one |
|---|---|
| PubChem CID | 157094116 |
| Molecular Formula | C44H61N2O5S+ |
| Molecular Weight | 730.05 g/mol |
| Exact Mass | 729.43 |
| IUPAC Name | 2-[(E)-[3-decyl-5-(hydroxymethyl)-1,3-benzoxazol-2-ylidene]methyl]-4-[(3-decyl-6-propan-2-yloxy-1,3-benzothiazol-3-ium-2-yl)methylidene]-3-hydroxycyclobut-2-en-1-one |
| SMILES | CCCCCCCCCCN1/C(=C\C2=C(O)C(=Cc3sc4cc(OC(C)C)ccc4[n+]3CCCCCCCCCC)C2=O)Oc2ccc(CO)cc21 |
| InChI | InChI=1S/C44H60N2O5S/c1-5-7-9-11-13-15-17-19-25-45-38-27-33(31-47)21-24-39(38)51-41(45)29-35-43(48)36(44(35)49)30-42-46(26-20-18-16-14-12-10-8-6-2)37-23-22-34(50-32(3)4)28-40(37)52-42/h21-24,27-30,32,47H,5-20,25-26,31H2,1-4H3/p+1 |
| InChIKey | MVAIQBKRTZPXNP-UHFFFAOYSA-O |
| XLogP | 11.27 |
| TPSA | 83.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.05 |
| LogP ≤ 5 | 11.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|