C36H33N2O2S2+ — CID 134295513
4-[(3-butylbenzo[g][1,3]benzothiazol-3-ium-2-yl)methylidene]-2-[(3-butylbenzo[g][1,3]benzothiazol-2-ylidene)methyl]-3-hydroxycyclobut-2-en-1-one (PubChem CID 134295513) has the molecular formula C36H33N2O2S2+ and a molecular weight of 589.81 g/mol. Its IUPAC name is 4-[(3-butylbenzo[g][1,3]benzothiazol-3-ium-2-yl)methylidene]-2-[(3-butylbenzo[g][1,3]benzothiazol-2-ylidene)methyl]-3-hydroxycyclobut-2-en-1-one.
| Compound Name | 4-[(3-butylbenzo[g][1,3]benzothiazol-3-ium-2-yl)methylidene]-2-[(3-butylbenzo[g][1,3]benzothiazol-2-ylidene)methyl]-3-hydroxycyclobut-2-en-1-one |
|---|---|
| PubChem CID | 134295513 |
| Molecular Formula | C36H33N2O2S2+ |
| Molecular Weight | 589.81 g/mol |
| Exact Mass | 589.20 |
| IUPAC Name | 4-[(3-butylbenzo[g][1,3]benzothiazol-3-ium-2-yl)methylidene]-2-[(3-butylbenzo[g][1,3]benzothiazol-2-ylidene)methyl]-3-hydroxycyclobut-2-en-1-one |
| SMILES | CCCCN1C(=CC2=C(O)C(=Cc3sc4c5ccccc5ccc4[n+]3CCCC)C2=O)Sc2c1ccc1ccccc21 |
| InChI | InChI=1S/C36H32N2O2S2/c1-3-5-19-37-29-17-15-23-11-7-9-13-25(23)35(29)41-31(37)21-27-33(39)28(34(27)40)22-32-38(20-6-4-2)30-18-16-24-12-8-10-14-26(24)36(30)42-32/h7-18,21-22H,3-6,19-20H2,1-2H3/p+1 |
| InChIKey | SCWJJZGJEPWIMG-UHFFFAOYSA-O |
| XLogP | 9.33 |
| TPSA | 44.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.81 |
| LogP ≤ 5 | 9.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|