C31H29N4OS2+ — CID 136811996
2-[4-[(3-butyl-1,3-benzothiazol-3-ium-2-yl)methylidene]-2-[(3-butyl-1,3-benzothiazol-2-ylidene)methyl]-3-oxocyclobuten-1-yl]-3-iminoprop-2-enenitrile (PubChem CID 136811996) has the molecular formula C31H29N4OS2+ and a molecular weight of 537.73 g/mol. Its IUPAC name is 2-[4-[(3-butyl-1,3-benzothiazol-3-ium-2-yl)methylidene]-2-[(3-butyl-1,3-benzothiazol-2-ylidene)methyl]-3-oxocyclobuten-1-yl]-3-iminoprop-2-enenitrile.
| Compound Name | 2-[4-[(3-butyl-1,3-benzothiazol-3-ium-2-yl)methylidene]-2-[(3-butyl-1,3-benzothiazol-2-ylidene)methyl]-3-oxocyclobuten-1-yl]-3-iminoprop-2-enenitrile |
|---|---|
| PubChem CID | 136811996 |
| Molecular Formula | C31H29N4OS2+ |
| Molecular Weight | 537.73 g/mol |
| Exact Mass | 537.18 |
| IUPAC Name | 2-[4-[(3-butyl-1,3-benzothiazol-3-ium-2-yl)methylidene]-2-[(3-butyl-1,3-benzothiazol-2-ylidene)methyl]-3-oxocyclobuten-1-yl]-3-iminoprop-2-enenitrile |
| SMILES | CCCCN1C(=CC2=C(C(=C=N)C#N)C(=Cc3sc4ccccc4[n+]3CCCC)C2=O)Sc2ccccc21 |
| InChI | InChI=1S/C31H29N4OS2/c1-3-5-15-34-24-11-7-9-13-26(24)37-28(34)17-22-30(21(19-32)20-33)23(31(22)36)18-29-35(16-6-4-2)25-12-8-10-14-27(25)38-29/h7-14,17-18,32H,3-6,15-16H2,1-2H3/q+1 |
| InChIKey | WWNREFRDLIWVSD-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 71.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.73 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|