C42H55Cl3N3O2S+ — CID 123522742
4-[(5-chloro-3-decyl-1,3-benzothiazol-3-ium-2-yl)methylidene]-2-[(5,6-dichloro-1-decyl-3-ethylbenzimidazol-2-ylidene)methyl]-3-hydroxycyclobut-2-en-1-one (PubChem CID 123522742) has the molecular formula C42H55Cl3N3O2S+ and a molecular weight of 772.35 g/mol. Its IUPAC name is 4-[(5-chloro-3-decyl-1,3-benzothiazol-3-ium-2-yl)methylidene]-2-[(5,6-dichloro-1-decyl-3-ethylbenzimidazol-2-ylidene)methyl]-3-hydroxycyclobut-2-en-1-one.
| Compound Name | 4-[(5-chloro-3-decyl-1,3-benzothiazol-3-ium-2-yl)methylidene]-2-[(5,6-dichloro-1-decyl-3-ethylbenzimidazol-2-ylidene)methyl]-3-hydroxycyclobut-2-en-1-one |
|---|---|
| PubChem CID | 123522742 |
| Molecular Formula | C42H55Cl3N3O2S+ |
| Molecular Weight | 772.35 g/mol |
| Exact Mass | 770.31 |
| IUPAC Name | 4-[(5-chloro-3-decyl-1,3-benzothiazol-3-ium-2-yl)methylidene]-2-[(5,6-dichloro-1-decyl-3-ethylbenzimidazol-2-ylidene)methyl]-3-hydroxycyclobut-2-en-1-one |
| SMILES | CCCCCCCCCCN1C(=CC2=C(O)C(=Cc3sc4ccc(Cl)cc4[n+]3CCCCCCCCCC)C2=O)N(CC)c2cc(Cl)c(Cl)cc21 |
| InChI | InChI=1S/C42H54Cl3N3O2S/c1-4-7-9-11-13-15-17-19-23-47-36-29-34(45)33(44)28-35(36)46(6-3)39(47)26-31-41(49)32(42(31)50)27-40-48(24-20-18-16-14-12-10-8-5-2)37-25-30(43)21-22-38(37)51-40/h21-22,25-29H,4-20,23-24H2,1-3H3/p+1 |
| InChIKey | ASXAPQMHLLZLEE-UHFFFAOYSA-O |
| XLogP | 13.40 |
| TPSA | 47.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 772.35 |
| LogP ≤ 5 | 13.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|