C40H50N2O6S2 — CID 59538896
(4Z)-4-[[3-(6-butoxy-6-oxohexyl)-1,3-benzothiazol-3-ium-2-yl]methylidene]-2-[[3-(6-butoxy-6-oxohexyl)-2H-1,3-benzothiazol-2-yl]methyl]-3-oxocyclobuten-1-olate (PubChem CID 59538896) has the molecular formula C40H50N2O6S2 and a molecular weight of 718.98 g/mol. Its IUPAC name is (4Z)-4-[[3-(6-butoxy-6-oxohexyl)-1,3-benzothiazol-3-ium-2-yl]methylidene]-2-[[3-(6-butoxy-6-oxohexyl)-2H-1,3-benzothiazol-2-yl]methyl]-3-oxocyclobuten-1-olate.
| Compound Name | (4Z)-4-[[3-(6-butoxy-6-oxohexyl)-1,3-benzothiazol-3-ium-2-yl]methylidene]-2-[[3-(6-butoxy-6-oxohexyl)-2H-1,3-benzothiazol-2-yl]methyl]-3-oxocyclobuten-1-olate |
|---|---|
| PubChem CID | 59538896 |
| Molecular Formula | C40H50N2O6S2 |
| Molecular Weight | 718.98 g/mol |
| Exact Mass | 718.31 |
| IUPAC Name | (4Z)-4-[[3-(6-butoxy-6-oxohexyl)-1,3-benzothiazol-3-ium-2-yl]methylidene]-2-[[3-(6-butoxy-6-oxohexyl)-2H-1,3-benzothiazol-2-yl]methyl]-3-oxocyclobuten-1-olate |
| SMILES | CCCCOC(=O)CCCCCN1c2ccccc2SC1CC1=C([O-])/C(=C/c2sc3ccccc3[n+]2CCCCCC(=O)OCCCC)C1=O |
| InChI | InChI=1S/C40H50N2O6S2/c1-3-5-25-47-37(43)21-9-7-15-23-41-31-17-11-13-19-33(31)49-35(41)27-29-39(45)30(40(29)46)28-36-42(32-18-12-14-20-34(32)50-36)24-16-8-10-22-38(44)48-26-6-4-2/h11-14,17-20,27,36H,3-10,15-16,21-26,28H2,1-2H3 |
| InChIKey | QCHPFKSLEFUTAH-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 99.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.98 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|