C34H33N2S2+ — CID 3919848
2-[2-benzyl-3-(3-ethyl-5,6-dimethyl-1,3-benzothiazol-2-ylidene)prop-1-enyl]-3-ethylbenzo[g][1,3]benzothiazol-3-ium (PubChem CID 3919848) has the molecular formula C34H33N2S2+ and a molecular weight of 533.79 g/mol. Its IUPAC name is 2-[2-benzyl-3-(3-ethyl-5,6-dimethyl-1,3-benzothiazol-2-ylidene)prop-1-enyl]-3-ethylbenzo[g][1,3]benzothiazol-3-ium.
| Compound Name | 2-[2-benzyl-3-(3-ethyl-5,6-dimethyl-1,3-benzothiazol-2-ylidene)prop-1-enyl]-3-ethylbenzo[g][1,3]benzothiazol-3-ium |
|---|---|
| PubChem CID | 3919848 |
| Molecular Formula | C34H33N2S2+ |
| Molecular Weight | 533.79 g/mol |
| Exact Mass | 533.21 |
| IUPAC Name | 2-[2-benzyl-3-(3-ethyl-5,6-dimethyl-1,3-benzothiazol-2-ylidene)prop-1-enyl]-3-ethylbenzo[g][1,3]benzothiazol-3-ium |
| SMILES | CCN1C(=CC(=Cc2sc3c4ccccc4ccc3[n+]2CC)Cc2ccccc2)Sc2cc(C)c(C)cc21 |
| InChI | InChI=1S/C34H33N2S2/c1-5-35-29-17-16-27-14-10-11-15-28(27)34(29)38-33(35)22-26(20-25-12-8-7-9-13-25)21-32-36(6-2)30-18-23(3)24(4)19-31(30)37-32/h7-19,21-22H,5-6,20H2,1-4H3/q+1 |
| InChIKey | ZTFJYMFLVAGZKP-UHFFFAOYSA-N |
| XLogP | 9.08 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.79 |
| LogP ≤ 5 | 9.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|