C13H12BrNS — CID 11098381
3-ethylbenzo[g][1,3]benzothiazol-3-ium bromide (PubChem CID 11098381) has the molecular formula C13H12BrNS and a molecular weight of 294.22 g/mol. Its IUPAC name is 3-ethylbenzo[g][1,3]benzothiazol-3-ium bromide.
| Compound Name | 3-ethylbenzo[g][1,3]benzothiazol-3-ium bromide |
|---|---|
| PubChem CID | 11098381 |
| Molecular Formula | C13H12BrNS |
| Molecular Weight | 294.22 g/mol |
| Exact Mass | 292.99 |
| IUPAC Name | 3-ethylbenzo[g][1,3]benzothiazol-3-ium bromide |
| SMILES | CC[n+]1csc2c3ccccc3ccc21.[Br-] |
| InChI | InChI=1S/C13H12NS.BrH/c1-2-14-9-15-13-11-6-4-3-5-10(11)7-8-12(13)14;/h3-9H,2H2,1H3;1H/q+1;/p-1 |
| InChIKey | WUXJVTWMWYVNBU-UHFFFAOYSA-M |
| XLogP | 0.37 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.22 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|