C12H13IN2S — CID 126467920
1-ethyl-2-methyl-4H-[1,3]thiazolo[5,4-b]indol-1-ium iodide (PubChem CID 126467920) has the molecular formula C12H13IN2S and a molecular weight of 344.22 g/mol. Its IUPAC name is 1-ethyl-2-methyl-4H-[1,3]thiazolo[5,4-b]indol-1-ium iodide.
| Compound Name | 1-ethyl-2-methyl-4H-[1,3]thiazolo[5,4-b]indol-1-ium iodide |
|---|---|
| PubChem CID | 126467920 |
| Molecular Formula | C12H13IN2S |
| Molecular Weight | 344.22 g/mol |
| Exact Mass | 343.98 |
| IUPAC Name | 1-ethyl-2-methyl-4H-[1,3]thiazolo[5,4-b]indol-1-ium iodide |
| SMILES | CC[n+]1c(C)sc2[nH]c3ccccc3c21.[I-] |
| InChI | InChI=1S/C12H13N2S.HI/c1-3-14-8(2)15-12-11(14)9-6-4-5-7-10(9)13-12;/h4-7,13H,3H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | MFOUXUWETNWVSO-UHFFFAOYSA-M |
| XLogP | 0.00 |
| TPSA | 19.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.22 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|