C14H21N — CID 143059445
butane;2,3-dimethyl-1H-indole (PubChem CID 143059445) has the molecular formula C14H21N and a molecular weight of 203.33 g/mol. Its IUPAC name is butane;2,3-dimethyl-1H-indole.
| Compound Name | butane;2,3-dimethyl-1H-indole |
|---|---|
| PubChem CID | 143059445 |
| Molecular Formula | C14H21N |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | butane;2,3-dimethyl-1H-indole |
| SMILES | CCCC.Cc1[nH]c2ccccc2c1C |
| InChI | InChI=1S/C10H11N.C4H10/c1-7-8(2)11-10-6-4-3-5-9(7)10;1-3-4-2/h3-6,11H,1-2H3;3-4H2,1-2H3 |
| InChIKey | RCNVKXIUKGQDOW-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|