About 2,3-dimethyl-1H-indole;molecular hydrogen
2,3-dimethyl-1H-indole;molecular hydrogen (PubChem CID 142083168) has the molecular formula C10H13N
and a molecular weight of 147.22 g/mol. Its IUPAC name is 2,3-dimethyl-1H-indole;molecular hydrogen.
Molecular Properties
| Compound Name | 2,3-dimethyl-1H-indole;molecular hydrogen |
| PubChem CID | 142083168 |
| Molecular Formula | C10H13N |
| Molecular Weight | 147.22 g/mol |
| Exact Mass | 147.10 |
| IUPAC Name | 2,3-dimethyl-1H-indole;molecular hydrogen |
| SMILES | Cc1[nH]c2ccccc2c1C.[H][H] |
| InChI | InChI=1S/C10H11N.H2/c1-7-8(2)11-10-6-4-3-5-9(7)10;/h3-6,11H,1-2H3;1H |
| InChIKey | DHXOBPGEQSRTKU-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.22 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dimethyl-1H-indole;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethyl-1H-indole;molecular hydrogen?
The IUPAC name of 2,3-dimethyl-1H-indole;molecular hydrogen (CID 142083168) is 2,3-dimethyl-1H-indole;molecular hydrogen.
What is the SMILES notation for 2,3-dimethyl-1H-indole;molecular hydrogen?
The canonical SMILES for 2,3-dimethyl-1H-indole;molecular hydrogen is Cc1[nH]c2ccccc2c1C.[H][H].
What is the InChIKey of 2,3-dimethyl-1H-indole;molecular hydrogen?
The InChIKey is DHXOBPGEQSRTKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N.H2/c1-7-8(2)11-10-6-4-3-5-9(7)10;/h3-6,11H,1-2H3;1H.
What are the key properties of 2,3-dimethyl-1H-indole;molecular hydrogen?
2,3-dimethyl-1H-indole;molecular hydrogen has a molecular weight of 147.22 g/mol, XLogP of 3.03, 0 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethyl-1H-indole;molecular hydrogen is sourced from PubChem (CID 142083168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).