C17H15IN2 — CID 71681954
5,11-dimethyl-10H-indolo[3,2-b]quinolin-5-ium iodide (PubChem CID 71681954) has the molecular formula C17H15IN2 and a molecular weight of 374.23 g/mol. Its IUPAC name is 5,11-dimethyl-10H-indolo[3,2-b]quinolin-5-ium iodide.
| Compound Name | 5,11-dimethyl-10H-indolo[3,2-b]quinolin-5-ium iodide |
|---|---|
| PubChem CID | 71681954 |
| Molecular Formula | C17H15IN2 |
| Molecular Weight | 374.23 g/mol |
| Exact Mass | 374.03 |
| IUPAC Name | 5,11-dimethyl-10H-indolo[3,2-b]quinolin-5-ium iodide |
| SMILES | Cc1c2ccccc2[n+](C)c2c1[nH]c1ccccc12.[I-] |
| InChI | InChI=1S/C17H14N2.HI/c1-11-12-7-4-6-10-15(12)19(2)17-13-8-3-5-9-14(13)18-16(11)17;/h3-10H,1-2H3;1H |
| InChIKey | JFRGBVZQGNMWDT-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 19.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.23 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|