C10H14NS2+ — CID 947996
3-ethyl-2,5,6-trimethylthieno[2,3-d][1,3]thiazol-3-ium (PubChem CID 947996) has the molecular formula C10H14NS2+ and a molecular weight of 212.36 g/mol. Its IUPAC name is 3-ethyl-2,5,6-trimethylthieno[2,3-d][1,3]thiazol-3-ium.
| Compound Name | 3-ethyl-2,5,6-trimethylthieno[2,3-d][1,3]thiazol-3-ium |
|---|---|
| PubChem CID | 947996 |
| Molecular Formula | C10H14NS2+ |
| Molecular Weight | 212.36 g/mol |
| Exact Mass | 212.06 |
| IUPAC Name | 3-ethyl-2,5,6-trimethylthieno[2,3-d][1,3]thiazol-3-ium |
| SMILES | CC[n+]1c(C)sc2c(C)c(C)sc21 |
| InChI | InChI=1S/C10H14NS2/c1-5-11-8(4)13-9-6(2)7(3)12-10(9)11/h5H2,1-4H3/q+1 |
| InChIKey | MSKYONQDDILTOO-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.36 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|