C8H15ClN2 — CID 160819911
3-ethyl-2,4,5-trimethyl-1H-imidazol-3-ium chloride (PubChem CID 160819911) has the molecular formula C8H15ClN2 and a molecular weight of 174.67 g/mol. Its IUPAC name is 3-ethyl-2,4,5-trimethyl-1H-imidazol-3-ium chloride.
| Compound Name | 3-ethyl-2,4,5-trimethyl-1H-imidazol-3-ium chloride |
|---|---|
| PubChem CID | 160819911 |
| Molecular Formula | C8H15ClN2 |
| Molecular Weight | 174.67 g/mol |
| Exact Mass | 174.09 |
| IUPAC Name | 3-ethyl-2,4,5-trimethyl-1H-imidazol-3-ium chloride |
| SMILES | CC[n+]1c(C)[nH]c(C)c1C.[Cl-] |
| InChI | InChI=1S/C8H14N2.ClH/c1-5-10-7(3)6(2)9-8(10)4;/h5H2,1-4H3;1H |
| InChIKey | SFKCJOFBZIQYAO-UHFFFAOYSA-N |
| XLogP | -1.75 |
| TPSA | 19.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.67 |
| LogP ≤ 5 | -1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|