3-ethyl-2,4,5-trimethyl-1H-imidazol-3-ium chloride

C8H15ClN2 — CID 160819911

IUPAC3-ethyl-2,4,5-trimethyl-1H-imidazol-3-ium chloride
SMILESCC[n+]1c(C)[nH]c(C)c1C.[Cl-]
InChIInChI=1S/C8H14N2.ClH/c1-5-10-7(3)6(2)9-8(10)4;/h5H2,1-4H3;1H
InChIKeySFKCJOFBZIQYAO-UHFFFAOYSA-N
MW174.67 g/mol
LogP-1.75
Rot. Bonds1

About 3-ethyl-2,4,5-trimethyl-1H-imidazol-3-ium chloride

3-ethyl-2,4,5-trimethyl-1H-imidazol-3-ium chloride (PubChem CID 160819911) has the molecular formula C8H15ClN2 and a molecular weight of 174.67 g/mol. Its IUPAC name is 3-ethyl-2,4,5-trimethyl-1H-imidazol-3-ium chloride.

Molecular Properties

Compound Name3-ethyl-2,4,5-trimethyl-1H-imidazol-3-ium chloride
PubChem CID160819911
Molecular FormulaC8H15ClN2
Molecular Weight174.67 g/mol
Exact Mass174.09
IUPAC Name3-ethyl-2,4,5-trimethyl-1H-imidazol-3-ium chloride
SMILESCC[n+]1c(C)[nH]c(C)c1C.[Cl-]
InChIInChI=1S/C8H14N2.ClH/c1-5-10-7(3)6(2)9-8(10)4;/h5H2,1-4H3;1H
InChIKeySFKCJOFBZIQYAO-UHFFFAOYSA-N
XLogP-1.75
TPSA19.67 Ų
H-Bond Donors1
H-Bond Acceptors
Rotatable Bonds1
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500174.67
LogP ≤ 5-1.75
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 100

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}

Analyze 3-ethyl-2,4,5-trimethyl-1H-imidazol-3-ium chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-ethyl-2,4,5-trimethyl-1H-imidazol-3-ium chloride?
The IUPAC name of 3-ethyl-2,4,5-trimethyl-1H-imidazol-3-ium chloride (CID 160819911) is 3-ethyl-2,4,5-trimethyl-1H-imidazol-3-ium chloride.
What is the SMILES notation for 3-ethyl-2,4,5-trimethyl-1H-imidazol-3-ium chloride?
The canonical SMILES for 3-ethyl-2,4,5-trimethyl-1H-imidazol-3-ium chloride is CC[n+]1c(C)[nH]c(C)c1C.[Cl-].
What is the InChIKey of 3-ethyl-2,4,5-trimethyl-1H-imidazol-3-ium chloride?
The InChIKey is SFKCJOFBZIQYAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2.ClH/c1-5-10-7(3)6(2)9-8(10)4;/h5H2,1-4H3;1H.
What are the key properties of 3-ethyl-2,4,5-trimethyl-1H-imidazol-3-ium chloride?
3-ethyl-2,4,5-trimethyl-1H-imidazol-3-ium chloride has a molecular weight of 174.67 g/mol, XLogP of -1.75, 1 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-2,4,5-trimethyl-1H-imidazol-3-ium chloride is sourced from PubChem (CID 160819911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).