C15H29N2+ — CID 175307213
2,4-dibutyl-3,5-diethyl-1H-imidazol-3-ium (PubChem CID 175307213) has the molecular formula C15H29N2+ and a molecular weight of 237.41 g/mol. Its IUPAC name is 2,4-dibutyl-3,5-diethyl-1H-imidazol-3-ium.
| Compound Name | 2,4-dibutyl-3,5-diethyl-1H-imidazol-3-ium |
|---|---|
| PubChem CID | 175307213 |
| Molecular Formula | C15H29N2+ |
| Molecular Weight | 237.41 g/mol |
| Exact Mass | 237.23 |
| IUPAC Name | 2,4-dibutyl-3,5-diethyl-1H-imidazol-3-ium |
| SMILES | CCCCc1[nH]c(CC)c(CCCC)[n+]1CC |
| InChI | InChI=1S/C15H28N2/c1-5-9-11-14-13(7-3)16-15(12-10-6-2)17(14)8-4/h5-12H2,1-4H3/p+1 |
| InChIKey | AXRLYIIMVLGJPA-UHFFFAOYSA-O |
| XLogP | 3.57 |
| TPSA | 19.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.41 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|