2,3-dibutyl-1H-imidazol-3-ium hydroxide

C11H22N2O — CID 172851412

IUPAC2,3-dibutyl-1H-imidazol-3-ium hydroxide
SMILESCCCCc1[nH]cc[n+]1CCCC.[OH-]
InChIInChI=1S/C11H20N2.H2O/c1-3-5-7-11-12-8-10-13(11)9-6-4-2;/h8,10H,3-7,9H2,1-2H3;1H2
InChIKeyYCSUTFJWOQYRGS-UHFFFAOYSA-N
MW198.31 g/mol
LogP2.27
Rot. Bonds6

About 2,3-dibutyl-1H-imidazol-3-ium hydroxide

2,3-dibutyl-1H-imidazol-3-ium hydroxide (PubChem CID 172851412) has the molecular formula C11H22N2O and a molecular weight of 198.31 g/mol. Its IUPAC name is 2,3-dibutyl-1H-imidazol-3-ium hydroxide.

Molecular Properties

Compound Name2,3-dibutyl-1H-imidazol-3-ium hydroxide
PubChem CID172851412
Molecular FormulaC11H22N2O
Molecular Weight198.31 g/mol
Exact Mass198.17
IUPAC Name2,3-dibutyl-1H-imidazol-3-ium hydroxide
SMILESCCCCc1[nH]cc[n+]1CCCC.[OH-]
InChIInChI=1S/C11H20N2.H2O/c1-3-5-7-11-12-8-10-13(11)9-6-4-2;/h8,10H,3-7,9H2,1-2H3;1H2
InChIKeyYCSUTFJWOQYRGS-UHFFFAOYSA-N
XLogP2.27
TPSA49.67 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds6
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500198.31
LogP ≤ 52.27
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}

Analyze 2,3-dibutyl-1H-imidazol-3-ium hydroxide with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,3-dibutyl-1H-imidazol-3-ium hydroxide?
The IUPAC name of 2,3-dibutyl-1H-imidazol-3-ium hydroxide (CID 172851412) is 2,3-dibutyl-1H-imidazol-3-ium hydroxide.
What is the SMILES notation for 2,3-dibutyl-1H-imidazol-3-ium hydroxide?
The canonical SMILES for 2,3-dibutyl-1H-imidazol-3-ium hydroxide is CCCCc1[nH]cc[n+]1CCCC.[OH-].
What is the InChIKey of 2,3-dibutyl-1H-imidazol-3-ium hydroxide?
The InChIKey is YCSUTFJWOQYRGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N2.H2O/c1-3-5-7-11-12-8-10-13(11)9-6-4-2;/h8,10H,3-7,9H2,1-2H3;1H2.
What are the key properties of 2,3-dibutyl-1H-imidazol-3-ium hydroxide?
2,3-dibutyl-1H-imidazol-3-ium hydroxide has a molecular weight of 198.31 g/mol, XLogP of 2.27, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dibutyl-1H-imidazol-3-ium hydroxide is sourced from PubChem (CID 172851412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).