C11H22N2O — CID 172851412
2,3-dibutyl-1H-imidazol-3-ium hydroxide (PubChem CID 172851412) has the molecular formula C11H22N2O and a molecular weight of 198.31 g/mol. Its IUPAC name is 2,3-dibutyl-1H-imidazol-3-ium hydroxide.
| Compound Name | 2,3-dibutyl-1H-imidazol-3-ium hydroxide |
|---|---|
| PubChem CID | 172851412 |
| Molecular Formula | C11H22N2O |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.17 |
| IUPAC Name | 2,3-dibutyl-1H-imidazol-3-ium hydroxide |
| SMILES | CCCCc1[nH]cc[n+]1CCCC.[OH-] |
| InChI | InChI=1S/C11H20N2.H2O/c1-3-5-7-11-12-8-10-13(11)9-6-4-2;/h8,10H,3-7,9H2,1-2H3;1H2 |
| InChIKey | YCSUTFJWOQYRGS-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 49.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|