C13H22F3N2+ — CID 69095147
3-octyl-2-(2,2,2-trifluoroethyl)-1H-imidazol-3-ium (PubChem CID 69095147) has the molecular formula C13H22F3N2+ and a molecular weight of 263.33 g/mol. Its IUPAC name is 3-octyl-2-(2,2,2-trifluoroethyl)-1H-imidazol-3-ium.
| Compound Name | 3-octyl-2-(2,2,2-trifluoroethyl)-1H-imidazol-3-ium |
|---|---|
| PubChem CID | 69095147 |
| Molecular Formula | C13H22F3N2+ |
| Molecular Weight | 263.33 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | 3-octyl-2-(2,2,2-trifluoroethyl)-1H-imidazol-3-ium |
| SMILES | CCCCCCCC[n+]1cc[nH]c1CC(F)(F)F |
| InChI | InChI=1S/C13H21F3N2/c1-2-3-4-5-6-7-9-18-10-8-17-12(18)11-13(14,15)16/h8,10H,2-7,9,11H2,1H3/p+1 |
| InChIKey | QCNZGXGJBCKOKH-UHFFFAOYSA-O |
| XLogP | 3.77 |
| TPSA | 19.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.33 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|