C20H38FN4O3P — CID 157305144
fluoro-dioxido-oxo-λ5-phosphane;bis(3-hexyl-2-methyl-1H-imidazol-3-ium) (PubChem CID 157305144) has the molecular formula C20H38FN4O3P and a molecular weight of 432.52 g/mol. Its IUPAC name is fluoro-dioxido-oxo-λ5-phosphane;bis(3-hexyl-2-methyl-1H-imidazol-3-ium).
| Compound Name | fluoro-dioxido-oxo-λ5-phosphane;bis(3-hexyl-2-methyl-1H-imidazol-3-ium) |
|---|---|
| PubChem CID | 157305144 |
| Molecular Formula | C20H38FN4O3P |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.27 |
| IUPAC Name | fluoro-dioxido-oxo-λ5-phosphane;bis(3-hexyl-2-methyl-1H-imidazol-3-ium) |
| SMILES | CCCCCC[n+]1cc[nH]c1C.CCCCCC[n+]1cc[nH]c1C.O=P([O-])([O-])F |
| InChI | InChI=1S/2C10H18N2.FH2O3P/c2*1-3-4-5-6-8-12-9-7-11-10(12)2;1-5(2,3)4/h2*7,9H,3-6,8H2,1-2H3;(H2,2,3,4) |
| InChIKey | BCJLGBDQJNKBOV-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 102.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|