C12H22N2O2 — CID 141354861
butanoate;3-butyl-2-methyl-1H-imidazol-3-ium (PubChem CID 141354861) has the molecular formula C12H22N2O2 and a molecular weight of 226.32 g/mol. Its IUPAC name is butanoate;3-butyl-2-methyl-1H-imidazol-3-ium.
| Compound Name | butanoate;3-butyl-2-methyl-1H-imidazol-3-ium |
|---|---|
| PubChem CID | 141354861 |
| Molecular Formula | C12H22N2O2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | butanoate;3-butyl-2-methyl-1H-imidazol-3-ium |
| SMILES | CCCC(=O)[O-].CCCC[n+]1cc[nH]c1C |
| InChI | InChI=1S/C8H14N2.C4H8O2/c1-3-4-6-10-7-5-9-8(10)2;1-2-3-4(5)6/h5,7H,3-4,6H2,1-2H3;2-3H2,1H3,(H,5,6) |
| InChIKey | YAAAHTPJPGVMSY-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 59.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|